ChemNet > CAS > 1731-79-9 dimethyl dodecanedioate
1731-79-9 dimethyl dodecanedioate
| نام محصول |
dimethyl dodecanedioate |
| مترادف |
Dimethyl 1,10-decanedicarboxylate; 1,10-Decanedicarboxylic acid dimethyl ester~Dodecanedioic acid dimethyl ester; Dodecanedioic acid dimethyl ester; N-(2-Chloroethyl) Pyrrolinie HCl |
| میدان مغناطیسی |
C14H26O4 |
| وزن مولکولی |
258.3538 |
| InChI |
InChI=1/C14H26O4/c1-17-13(15)11-9-7-5-3-4-6-8-10-12-14(16)18-2/h3-12H2,1-2H3 |
| شماره سیایاس |
1731-79-9 |
| تعداد کمیسیون اروپایی |
217-050-6 |
| ساختار مولکولی |
|
| تراکم |
0.969g/cm3 |
| نقطه غلیان |
300.9°C at 760 mmHg |
| ضریب شکست |
1.441 |
| نقطه اشتعال |
135°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
