ChemNet > CAS > 1732-08-7 Dimethyl pimelate
1732-08-7 Dimethyl pimelate
| نام محصول |
Dimethyl pimelate |
| مترادف |
Dimethyl 1,7-Heptanedioate; Heptanedioic acid dimethyl ester; Pimelic acid dimethyl ester; dimethyl heptanedioate |
| میدان مغناطیسی |
C9H16O4 |
| وزن مولکولی |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-12-8(10)6-4-3-5-7-9(11)13-2/h3-7H2,1-2H3 |
| شماره سیایاس |
1732-08-7 |
| تعداد کمیسیون اروپایی |
217-057-4 |
| ساختار مولکولی |
|
| تراکم |
1.022g/cm3 |
| نقطه غلیان |
250.3°C at 760 mmHg |
| ضریب شکست |
1.427 |
| نقطه اشتعال |
105.4°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
