ChemNet > CAS > 17377-95-6 Benzylanisidine
17377-95-6 Benzylanisidine
نام محصول |
Benzylanisidine |
مترادف |
N-Benzyl-4-anisidine; N-Benzyl-4-methoxyaniline |
میدان مغناطیسی |
C14H15NO |
وزن مولکولی |
213.275 |
InChI |
InChI=1/C14H15NO/c1-16-14-9-7-13(8-10-14)15-11-12-5-3-2-4-6-12/h2-10,15H,11H2,1H3 |
شماره سیایاس |
17377-95-6 |
ساختار مولکولی |
|
تراکم |
1.101g/cm3 |
نقطه غلیان |
348.7°C at 760 mmHg |
ضریب شکست |
1.608 |
نقطه اشتعال |
141.6°C |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|