ChemNet > CAS > 175135-63-4 3-amino-2-(2,4-difluorophenoxy)pyridine
175135-63-4 3-amino-2-(2,4-difluorophenoxy)pyridine
نام محصول |
3-amino-2-(2,4-difluorophenoxy)pyridine |
مترادف |
2-(2,4-Difluorophenoxy)pyridin-3-amine; 2-(4-fluorophenoxy)pyridin-3-amine |
میدان مغناطیسی |
C11H9FN2O |
وزن مولکولی |
204.2004 |
InChI |
InChI=1/C11H9FN2O/c12-8-3-5-9(6-4-8)15-11-10(13)2-1-7-14-11/h1-7H,13H2 |
شماره سیایاس |
175135-63-4 |
ساختار مولکولی |
|
تراکم |
1.278g/cm3 |
نقطه ذوب |
95-96℃ |
نقطه غلیان |
328.8°C at 760 mmHg |
ضریب شکست |
1.605 |
نقطه اشتعال |
152.7°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|