ChemNet > CAS > 175136-79-5 1-(3,5-dichlorophenyl)-1H-pyrrole-2-carbaldehyde
175136-79-5 1-(3,5-dichlorophenyl)-1H-pyrrole-2-carbaldehyde
نام محصول |
1-(3,5-dichlorophenyl)-1H-pyrrole-2-carbaldehyde |
مترادف |
1-(3,5-dichlorophenyl)-1h-pyrrole-2-carboxaldehyde |
میدان مغناطیسی |
C11H7Cl2NO |
وزن مولکولی |
240.0854 |
InChI |
InChI=1/C11H7Cl2NO/c12-8-4-9(13)6-11(5-8)14-3-1-2-10(14)7-15/h1-7H |
شماره سیایاس |
175136-79-5 |
ساختار مولکولی |
|
تراکم |
1.33g/cm3 |
نقطه ذوب |
153℃ |
نقطه غلیان |
384.3°C at 760 mmHg |
ضریب شکست |
1.609 |
نقطه اشتعال |
186.2°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|