ChemNet > CAS > 175203-52-8 1,4-dimethylpiperazine-2-carbohydrazide
175203-52-8 1,4-dimethylpiperazine-2-carbohydrazide
نام محصول |
1,4-dimethylpiperazine-2-carbohydrazide |
میدان مغناطیسی |
C7H16N4O |
وزن مولکولی |
172.2281 |
InChI |
InChI=1/C7H16N4O/c1-10-3-4-11(2)6(5-10)7(12)9-8/h6H,3-5,8H2,1-2H3,(H,9,12) |
شماره سیایاس |
175203-52-8 |
ساختار مولکولی |
|
تراکم |
1.105g/cm3 |
نقطه ذوب |
105℃ |
نقطه غلیان |
339.7°C at 760 mmHg |
ضریب شکست |
1.511 |
نقطه اشتعال |
159.2°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|