ChemNet > CAS > 17530-69-7 3-Chloro-5,5-dimethyl-2-cyclohexen-1-one
17530-69-7 3-Chloro-5,5-dimethyl-2-cyclohexen-1-one
نام محصول |
3-Chloro-5,5-dimethyl-2-cyclohexen-1-one |
مترادف |
3-Chloro-5,5-dimethylcyclohex-2-enone; 3-chloro-5,5-dimethylcyclohex-2-en-1-one |
میدان مغناطیسی |
C8H11ClO |
وزن مولکولی |
158.6253 |
InChI |
InChI=1/C8H11ClO/c1-8(2)4-6(9)3-7(10)5-8/h3H,4-5H2,1-2H3 |
شماره سیایاس |
17530-69-7 |
ساختار مولکولی |
|
تراکم |
1.09g/cm3 |
نقطه غلیان |
217.7°C at 760 mmHg |
ضریب شکست |
1.488 |
نقطه اشتعال |
104.8°C |
خطر نمادها |
|
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|