ChemNet > CAS > 177842-14-7 4-(difluoromethoxy)benzylamine
177842-14-7 4-(difluoromethoxy)benzylamine
نام محصول |
4-(difluoromethoxy)benzylamine |
مترادف |
1-[4-(difluoromethoxy)phenyl]methanamine |
میدان مغناطیسی |
C8H9F2NO |
وزن مولکولی |
173.16 |
InChI |
InChI=1/C8H9F2NO/c9-8(10)12-7-3-1-6(5-11)2-4-7/h1-4,8H,5,11H2 |
شماره سیایاس |
177842-14-7 |
ساختار مولکولی |
|
تراکم |
1.196g/cm3 |
نقطه غلیان |
227.3°C at 760 mmHg |
ضریب شکست |
1.487 |
نقطه اشتعال |
91.3°C |
خطر نمادها |
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|