ChemNet > CAS > 1780-17-2 2-quinolylmethanol
1780-17-2 2-quinolylmethanol
نام محصول |
2-quinolylmethanol |
مترادف |
2-Hydroxymethylquinoline; 2-Quinolinylmethanol; 2-Quinolinemethanol; quinolin-2-ylmethanol |
میدان مغناطیسی |
C10H9NO |
وزن مولکولی |
159.1846 |
InChI |
InChI=1/C10H9NO/c12-7-9-6-5-8-3-1-2-4-10(8)11-9/h1-6,12H,7H2 |
شماره سیایاس |
1780-17-2 |
تعداد کمیسیون اروپایی |
217-225-7 |
ساختار مولکولی |
|
تراکم |
1.218g/cm3 |
نقطه غلیان |
310.6°C at 760 mmHg |
ضریب شکست |
1.667 |
نقطه اشتعال |
141.6°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|