ChemNet > CAS > 17846-15-0 adamantane-1-carbohydrazide
17846-15-0 adamantane-1-carbohydrazide
نام محصول |
adamantane-1-carbohydrazide |
مترادف |
tricyclo[3.3.1.1~3,7~]decane-1-carbohydrazide |
میدان مغناطیسی |
C11H18N2O |
وزن مولکولی |
194.2734 |
InChI |
InChI=1/C11H18N2O/c12-13-10(14)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6,12H2,(H,13,14) |
شماره سیایاس |
17846-15-0 |
ساختار مولکولی |
|
تراکم |
1.203g/cm3 |
نقطه ذوب |
157℃ |
نقطه غلیان |
370.8°C at 760 mmHg |
ضریب شکست |
1.581 |
نقطه اشتعال |
178°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|