ChemNet > CAS > 18362-64-6 2,6-Dimethyl-3,5-heptanedione
18362-64-6 2,6-Dimethyl-3,5-heptanedione
نام محصول |
2,6-Dimethyl-3,5-heptanedione |
مترادف |
2,6-dimethylheptane-3,5-dione; (4Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one |
میدان مغناطیسی |
C9H16O2 |
وزن مولکولی |
156.2221 |
InChI |
InChI=1/C9H16O2/c1-6(2)8(10)5-9(11)7(3)4/h5-7,10H,1-4H3/b8-5- |
شماره سیایاس |
18362-64-6 |
تعداد کمیسیون اروپایی |
242-234-8 |
ساختار مولکولی |
|
تراکم |
0.941g/cm3 |
نقطه غلیان |
239.2°C at 760 mmHg |
ضریب شکست |
1.456 |
نقطه اشتعال |
97.8°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|