ChemNet > CAS > 18856-63-8 4-Ethylphenyl isothiocyanate
18856-63-8 4-Ethylphenyl isothiocyanate
| نام محصول |
4-Ethylphenyl isothiocyanate |
| مترادف |
4-Ethylisothiocyanatobenzene; 1-ethyl-4-isothiocyanatobenzene |
| میدان مغناطیسی |
C9H9NS |
| وزن مولکولی |
163.2395 |
| InChI |
InChI=1/C9H9NS/c1-2-8-3-5-9(6-4-8)10-7-11/h3-6H,2H2,1H3 |
| شماره سیایاس |
18856-63-8 |
| ساختار مولکولی |
|
| تراکم |
1.01g/cm3 |
| نقطه غلیان |
257.8°C at 760 mmHg |
| ضریب شکست |
1.553 |
| نقطه اشتعال |
110.2°C |
| خطر نمادها |
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
