ChemNet > CAS > 19013-10-6 Ethyl 4-hydroxy-3-nitrobenzoate
19013-10-6 Ethyl 4-hydroxy-3-nitrobenzoate
نام محصول |
Ethyl 4-hydroxy-3-nitrobenzoate |
مترادف |
4-Hydroxy-3-nitrobenzoic acid ethyl ester |
میدان مغناطیسی |
C9H9NO5 |
وزن مولکولی |
211.1715 |
InChI |
InChI=1/C9H9NO5/c1-2-15-9(12)6-3-4-8(11)7(5-6)10(13)14/h3-5,11H,2H2,1H3 |
شماره سیایاس |
19013-10-6 |
تعداد کمیسیون اروپایی |
242-751-9 |
ساختار مولکولی |
|
تراکم |
1.37g/cm3 |
نقطه غلیان |
323.5°C at 760 mmHg |
ضریب شکست |
1.577 |
نقطه اشتعال |
149.5°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|