ChemNet > CAS > 2001-29-8 benzyl 4-brornophenyl ketone
2001-29-8 benzyl 4-brornophenyl ketone
| نام محصول |
benzyl 4-brornophenyl ketone |
| مترادف |
4-Bromodeoxybenzoin~4-Bromo-alpha-phenylacetophenone; Benzyl 4-bromophenyl ketone; 1-(4-bromophenyl)-2-phenylethanone; 4'-Bromo-2-Phenylacetophenone |
| میدان مغناطیسی |
C14H11BrO |
| وزن مولکولی |
275.1405 |
| InChI |
InChI=1/C14H11BrO/c15-13-8-6-12(7-9-13)14(16)10-11-4-2-1-3-5-11/h1-9H,10H2 |
| شماره سیایاس |
2001-29-8 |
| ساختار مولکولی |
|
| تراکم |
1.39g/cm3 |
| نقطه ذوب |
112-116℃ |
| نقطه غلیان |
383.2°C at 760 mmHg |
| ضریب شکست |
1.608 |
| نقطه اشتعال |
84.6°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
