ChemNet > CAS > 20256-39-7 2-Acetamido-5-chlorothiazole
20256-39-7 2-Acetamido-5-chlorothiazole
نام محصول |
2-Acetamido-5-chlorothiazole |
مترادف |
N-(5-chloro-1,3-thiazol-2-yl)acetamide |
میدان مغناطیسی |
C5H5ClN2OS |
وزن مولکولی |
176.624 |
InChI |
InChI=1/C5H5ClN2OS/c1-3(9)8-5-7-2-4(6)10-5/h2H,1H3,(H,7,8,9) |
شماره سیایاس |
20256-39-7 |
ساختار مولکولی |
|
تراکم |
1.507g/cm3 |
ضریب شکست |
1.633 |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|