ChemNet > CAS > 202865-73-4 2-Bromo-4-fluoro-1-iodobenzene
202865-73-4 2-Bromo-4-fluoro-1-iodobenzene
| نام محصول |
2-Bromo-4-fluoro-1-iodobenzene |
| مترادف |
2-Bromo-4-fluoroiodobenzene |
| میدان مغناطیسی |
C6H3BrFI |
| وزن مولکولی |
300.8949 |
| InChI |
InChI=1/C6H3BrFI/c7-5-3-4(8)1-2-6(5)9/h1-3H |
| شماره سیایاس |
202865-73-4 |
| ساختار مولکولی |
|
| تراکم |
2.281g/cm3 |
| نقطه غلیان |
243.2°C at 760 mmHg |
| ضریب شکست |
1.628 |
| نقطه اشتعال |
100.9°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
