ChemNet > CAS > 202925-07-3 3-Chloro-4-fluoroanisole
202925-07-3 3-Chloro-4-fluoroanisole
| نام محصول |
3-Chloro-4-fluoroanisole |
| مترادف |
2-chloro-1-fluoro-4-methoxybenzene |
| میدان مغناطیسی |
C7H6ClFO |
| وزن مولکولی |
160.5733 |
| InChI |
InChI=1/C7H6ClFO/c1-10-5-2-3-7(9)6(8)4-5/h2-4H,1H3 |
| شماره سیایاس |
202925-07-3 |
| ساختار مولکولی |
|
| تراکم |
1.239g/cm3 |
| نقطه غلیان |
202.8°C at 760 mmHg |
| ضریب شکست |
1.495 |
| نقطه اشتعال |
76.4°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
