ChemNet > CAS > 202925-07-3 3-Chloro-4-fluoroanisole
202925-07-3 3-Chloro-4-fluoroanisole
نام محصول |
3-Chloro-4-fluoroanisole |
مترادف |
2-chloro-1-fluoro-4-methoxybenzene |
میدان مغناطیسی |
C7H6ClFO |
وزن مولکولی |
160.5733 |
InChI |
InChI=1/C7H6ClFO/c1-10-5-2-3-7(9)6(8)4-5/h2-4H,1H3 |
شماره سیایاس |
202925-07-3 |
ساختار مولکولی |
|
تراکم |
1.239g/cm3 |
نقطه غلیان |
202.8°C at 760 mmHg |
ضریب شکست |
1.495 |
نقطه اشتعال |
76.4°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|