ChemNet > CAS > 208173-21-1 4-fluoro-2-(trifluoromethyl)acetophenone
208173-21-1 4-fluoro-2-(trifluoromethyl)acetophenone
| نام محصول |
4-fluoro-2-(trifluoromethyl)acetophenone |
| مترادف |
4'-fluoro-2'-(trifluoromethyl)acetophenone; 1-[4-fluoro-2-(trifluoromethyl)phenyl]ethanone; 4'-Fluoro-2'-trifluoromethylacetophenone; 4-Fluoro-2-trifluoromethylacetophenone |
| میدان مغناطیسی |
C9H9FO2 |
| وزن مولکولی |
168.165 |
| InChI |
InChI=1/C9H9FO2/c1-6(11)7-3-4-8(10)9(5-7)12-2/h3-5H,1-2H3 |
| شماره سیایاس |
208173-21-1 |
| ساختار مولکولی |
|
| تراکم |
1.127g/cm3 |
| نقطه غلیان |
246°C at 760 mmHg |
| ضریب شکست |
1.487 |
| نقطه اشتعال |
99.6°C |
| خطر نمادها |
|
| کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
