CAS No: 21017-05-0, Chemical Name: (2S,3S,4R,5R)-2-(chloromethyl)-5-(6-hydroxypurin-9-yl)tetrahydrofuran-3,4-diol
the physical and chemical property of 21017-05-0, (2S,3S,4R,5R)-2-(chloromethyl)-5-(6-hydroxypurin-9-yl)tetrahydrofuran-3,4-diol is provided by ChemNet.com
ChemNet > CAS > 21017-05-0 (2S,3S,4R,5R)-2-(chloromethyl)-5-(6-hydroxypurin-9-yl)tetrahydrofuran-3,4-diol
21017-05-0 (2S,3S,4R,5R)-2-(chloromethyl)-5-(6-hydroxypurin-9-yl)tetrahydrofuran-3,4-diol
| نام محصول |
(2S,3S,4R,5R)-2-(chloromethyl)-5-(6-hydroxypurin-9-yl)tetrahydrofuran-3,4-diol |
| مترادف |
5'-Chloro-5'-deoxyinosine; 9-(5-Chloro-5-deoxy-β-D-ribofuranosyl)-9H-purin-6-ol; 9H-purin-6-ol, 9-(5-chloro-5-deoxy-β-D-ribofuranosyl)- |
| میدان مغناطیسی |
C10H11ClN4O4 |
| وزن مولکولی |
286.6717 |
| InChI |
InChI=1/C10H11ClN4O4/c11-1-4-6(16)7(17)10(19-4)15-3-14-5-8(15)12-2-13-9(5)18/h2-4,6-7,10,16-17H,1H2,(H,12,13,18)/t4-,6-,7-,10-/m1/s1 |
| شماره سیایاس |
21017-05-0 |
| ساختار مولکولی |
|
| تراکم |
2.03g/cm3 |
| نقطه غلیان |
639.1°C at 760 mmHg |
| ضریب شکست |
1.846 |
| نقطه اشتعال |
340.3°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
|
|
