ChemNet > CAS > 2113-58-8 3-Nitrobiphenyl
2113-58-8 3-Nitrobiphenyl
نام محصول |
3-Nitrobiphenyl |
مترادف |
3-Nitrodiphenyl |
میدان مغناطیسی |
C12H9NO2 |
وزن مولکولی |
199.2054 |
InChI |
InChI=1/C12H9NO2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
شماره سیایاس |
2113-58-8 |
تعداد کمیسیون اروپایی |
218-305-4 |
ساختار مولکولی |
|
تراکم |
1.196g/cm3 |
نقطه ذوب |
56-60℃ |
نقطه غلیان |
339°C at 760 mmHg |
ضریب شکست |
1.605 |
نقطه اشتعال |
161.4°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R40:Possible risks of irreversible effects.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|