ChemNet > CAS > 21211-07-4 Methyl 3-chlorobenzo(b)thiophene-2-carboxylate
21211-07-4 Methyl 3-chlorobenzo(b)thiophene-2-carboxylate
| نام محصول |
Methyl 3-chlorobenzo(b)thiophene-2-carboxylate |
| مترادف |
Methylchlorobenzobthiophenecarboxylate; methyl 3-chloro-1-benzothiophene-2-carboxylate; Methyl 3-chlorobenzo[b]thiophene-2-carboxylate |
| میدان مغناطیسی |
C10H7ClO2S |
| وزن مولکولی |
226.6794 |
| InChI |
InChI=1/C10H7ClO2S/c1-13-10(12)9-8(11)6-4-2-3-5-7(6)14-9/h2-5H,1H3 |
| شماره سیایاس |
21211-07-4 |
| ساختار مولکولی |
|
| تراکم |
1.391g/cm3 |
| نقطه ذوب |
80-82℃ |
| نقطه غلیان |
338.8°C at 760 mmHg |
| ضریب شکست |
1.646 |
| نقطه اشتعال |
158.7°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
