ChemNet > CAS > 21298-53-3 3-(2-Thienyl)pyridine
21298-53-3 3-(2-Thienyl)pyridine
نام محصول |
3-(2-Thienyl)pyridine |
مترادف |
2-(3-Pyridyl)thiophene; 3-(thiophen-2-yl)pyridine |
میدان مغناطیسی |
C9H7NS |
وزن مولکولی |
161.2236 |
InChI |
InChI=1/C9H7NS/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1-7H |
شماره سیایاس |
21298-53-3 |
ساختار مولکولی |
|
تراکم |
1.173g/cm3 |
نقطه غلیان |
278.6°C at 760 mmHg |
ضریب شکست |
1.604 |
نقطه اشتعال |
121.8°C |
خطر نمادها |
|
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|