ChemNet > CAS > 215655-20-2 1-(2-chloro-6-fluorobenzyl)piperazine
215655-20-2 1-(2-chloro-6-fluorobenzyl)piperazine
نام محصول |
1-(2-chloro-6-fluorobenzyl)piperazine |
میدان مغناطیسی |
C11H14ClFN2 |
وزن مولکولی |
228.6937 |
InChI |
InChI=1/C11H14ClFN2/c12-10-2-1-3-11(13)9(10)8-15-6-4-14-5-7-15/h1-3,14H,4-8H2 |
شماره سیایاس |
215655-20-2 |
ساختار مولکولی |
|
تراکم |
1.216g/cm3 |
نقطه غلیان |
299.7°C at 760 mmHg |
ضریب شکست |
1.544 |
نقطه اشتعال |
135°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|