ChemNet > CAS > 220141-73-1 3,4,5-trifluoroacetophenone
220141-73-1 3,4,5-trifluoroacetophenone
| نام محصول |
3,4,5-trifluoroacetophenone |
| مترادف |
3',4',5'-Trifluoroacetophenone; 1-(3,4,5-trifluorophenyl)ethanone |
| میدان مغناطیسی |
C8H5F3O |
| وزن مولکولی |
174.1199 |
| InChI |
InChI=1/C8H5F3O/c1-4(12)5-2-6(9)8(11)7(10)3-5/h2-3H,1H3 |
| شماره سیایاس |
220141-73-1 |
| ساختار مولکولی |
|
| تراکم |
1.303g/cm3 |
| نقطه غلیان |
208.8°C at 760 mmHg |
| ضریب شکست |
1.455 |
| نقطه اشتعال |
72.5°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
