ChemNet > CAS > 2257-69-4 4-chloro-1,2-dihydrophthalazin-1-one
2257-69-4 4-chloro-1,2-dihydrophthalazin-1-one
نام محصول |
4-chloro-1,2-dihydrophthalazin-1-one |
مترادف |
1-Chloro-3,4-dihydrophthalazin-4-one; 4-chlorophthalazin-1(2H)-one |
میدان مغناطیسی |
C8H5ClN2O |
وزن مولکولی |
180.5911 |
InChI |
InChI=1/C8H5ClN2O/c9-7-5-3-1-2-4-6(5)8(12)11-10-7/h1-4H,(H,11,12) |
شماره سیایاس |
2257-69-4 |
ساختار مولکولی |
|
تراکم |
1.5g/cm3 |
نقطه ذوب |
265℃ |
نقطه غلیان |
452.7°C at 760 mmHg |
ضریب شکست |
1.688 |
نقطه اشتعال |
227.6°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|