ChemNet > CAS > 22590-64-3 3-(oxiran-2-ylmethoxy)benzaldehyde
22590-64-3 3-(oxiran-2-ylmethoxy)benzaldehyde
| نام محصول |
3-(oxiran-2-ylmethoxy)benzaldehyde |
| میدان مغناطیسی |
C10H10O3 |
| وزن مولکولی |
178.1846 |
| InChI |
InChI=1/C10H10O3/c11-5-8-2-1-3-9(4-8)12-6-10-7-13-10/h1-5,10H,6-7H2 |
| شماره سیایاس |
22590-64-3 |
| ساختار مولکولی |
|
| تراکم |
1.225g/cm3 |
| نقطه غلیان |
318.2°C at 760 mmHg |
| ضریب شکست |
1.581 |
| نقطه اشتعال |
137.2°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
