ChemNet > CAS > 23132-21-0 2-Bromo-3-methyl-5-nitropyridine
23132-21-0 2-Bromo-3-methyl-5-nitropyridine
| نام محصول |
2-Bromo-3-methyl-5-nitropyridine |
| مترادف |
2-Bromo-5-nitro-3-picoline |
| میدان مغناطیسی |
C6H5BrN2O2 |
| وزن مولکولی |
217.0201 |
| InChI |
InChI=1/C6H5BrN2O2/c1-4-2-5(9(10)11)3-8-6(4)7/h2-3H,1H3 |
| شماره سیایاس |
23132-21-0 |
| ساختار مولکولی |
|
| تراکم |
1.709g/cm3 |
| نقطه غلیان |
305.1°C at 760 mmHg |
| ضریب شکست |
1.599 |
| نقطه اشتعال |
138.3°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
