ChemNet > CAS > 23583-21-3 Benzylaminopropionicacidethylester
23583-21-3 Benzylaminopropionicacidethylester
| نام محصول |
Benzylaminopropionicacidethylester |
| مترادف |
N-Benzyl-3-aminopropionic acid ethyl ester; N-Benzyl-beta-alanine ethyl ester; Bzl-beta-Ala-OEt~Ethyl 3-(benzylamino)propionate; ethyl N-benzyl-beta-alaninate; Ethyl 3-(Benzylamino)Propanoate |
| میدان مغناطیسی |
C12H17NO2 |
| وزن مولکولی |
207.2689 |
| InChI |
InChI=1/C12H17NO2/c1-2-15-12(14)8-9-13-10-11-6-4-3-5-7-11/h3-7,13H,2,8-10H2,1H3 |
| شماره سیایاس |
23583-21-3 |
| تعداد کمیسیون اروپایی |
245-759-0 |
| ساختار مولکولی |
|
| تراکم |
1.033g/cm3 |
| نقطه غلیان |
307.2°C at 760 mmHg |
| ضریب شکست |
1.507 |
| نقطه اشتعال |
139.6°C |
| خطر نمادها |
|
| کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
