ChemNet > CAS > 2393-97-7 Bis-(4-chlorophenylthio)methane
2393-97-7 Bis-(4-chlorophenylthio)methane
| نام محصول |
Bis-(4-chlorophenylthio)methane |
| مترادف |
Bis(4-chlorophenylthio)methane; 1,1'-(methanediyldisulfanediyl)bis(4-chlorobenzene) |
| میدان مغناطیسی |
C13H10Cl2S2 |
| وزن مولکولی |
301.2545 |
| InChI |
InChI=1/C13H10Cl2S2/c14-10-1-5-12(6-2-10)16-9-17-13-7-3-11(15)4-8-13/h1-8H,9H2 |
| شماره سیایاس |
2393-97-7 |
| ساختار مولکولی |
|
| تراکم |
1.38g/cm3 |
| نقطه ذوب |
45-48℃ |
| نقطه غلیان |
420.9°C at 760 mmHg |
| ضریب شکست |
1.677 |
| نقطه اشتعال |
192.5°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
