ChemNet > CAS > 2393-97-7 Bis-(4-chlorophenylthio)methane
2393-97-7 Bis-(4-chlorophenylthio)methane
نام محصول |
Bis-(4-chlorophenylthio)methane |
مترادف |
Bis(4-chlorophenylthio)methane; 1,1'-(methanediyldisulfanediyl)bis(4-chlorobenzene) |
میدان مغناطیسی |
C13H10Cl2S2 |
وزن مولکولی |
301.2545 |
InChI |
InChI=1/C13H10Cl2S2/c14-10-1-5-12(6-2-10)16-9-17-13-7-3-11(15)4-8-13/h1-8H,9H2 |
شماره سیایاس |
2393-97-7 |
ساختار مولکولی |
|
تراکم |
1.38g/cm3 |
نقطه ذوب |
45-48℃ |
نقطه غلیان |
420.9°C at 760 mmHg |
ضریب شکست |
1.677 |
نقطه اشتعال |
192.5°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|