ChemNet > CAS > 2402-79-1 2,3,5,6-tetrachloropyridine
2402-79-1 2,3,5,6-tetrachloropyridine
| نام محصول |
2,3,5,6-tetrachloropyridine |
| مترادف |
2,3,5,6-tetrachlopyridine; SYMTET |
| میدان مغناطیسی |
C5HCl4N |
| وزن مولکولی |
216.8801 |
| InChI |
InChI=1/C5HCl4N/c6-2-1-3(7)5(9)10-4(2)8/h1H |
| شماره سیایاس |
2402-79-1 |
| تعداد کمیسیون اروپایی |
219-283-9 |
| ساختار مولکولی |
|
| تراکم |
1.662g/cm3 |
| نقطه ذوب |
90.5℃ |
| نقطه غلیان |
253.7°C at 760 mmHg |
| ضریب شکست |
1.588 |
| نقطه اشتعال |
131.7°C |
| خطر نمادها |
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S60:This material and its container must be disposed of as hazardous waste.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
