ChemNet > CAS > 24044-07-3 2-(2-thienyl)-1,3-thiazole-4-carboxylic acid
24044-07-3 2-(2-thienyl)-1,3-thiazole-4-carboxylic acid
| نام محصول |
2-(2-thienyl)-1,3-thiazole-4-carboxylic acid |
| مترادف |
2-(thiophen-2-yl)thiazole-4-carboxylic acid; 2-(2-thienyl)thiazole-4-carboxylic acid; 2-thiophen-2-yl-1,3-thiazole-4-carboxylate |
| میدان مغناطیسی |
C8H4NO2S2 |
| وزن مولکولی |
210.2534 |
| InChI |
InChI=1/C8H5NO2S2/c10-8(11)5-4-13-7(9-5)6-2-1-3-12-6/h1-4H,(H,10,11)/p-1 |
| شماره سیایاس |
24044-07-3 |
| ساختار مولکولی |
|
| نقطه ذوب |
156℃ |
| نقطه غلیان |
441.5°C at 760 mmHg |
| نقطه اشتعال |
220.8°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
