ChemNet > CAS > 25084-14-4 5-Nitro-2-furoylchloride
25084-14-4 5-Nitro-2-furoylchloride
نام محصول |
5-Nitro-2-furoylchloride |
مترادف |
5-Nitro-2-furoyl chloride; 5-Nitrofuran-2-carbonyl chloride |
میدان مغناطیسی |
C5H2ClNO4 |
وزن مولکولی |
175.5267 |
InChI |
InChI=1/C5H2ClNO4/c6-5(8)3-1-2-4(11-3)7(9)10/h1-2H |
شماره سیایاس |
25084-14-4 |
تعداد کمیسیون اروپایی |
246-607-6 |
ساختار مولکولی |
|
تراکم |
1.588g/cm3 |
نقطه غلیان |
272.7°C at 760 mmHg |
ضریب شکست |
1.552 |
نقطه اشتعال |
118.7°C |
خطر نمادها |
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|