ChemNet > CAS > 255724-71-1 5-Fluoro-2-iodoaniline
255724-71-1 5-Fluoro-2-iodoaniline
| نام محصول |
5-Fluoro-2-iodoaniline |
| میدان مغناطیسی |
C6H5FIN |
| وزن مولکولی |
237.0135 |
| InChI |
InChI=1/C6H5FIN/c7-4-1-2-5(8)6(9)3-4/h1-3H,9H2 |
| شماره سیایاس |
255724-71-1 |
| ساختار مولکولی |
|
| تراکم |
2.008g/cm3 |
| نقطه غلیان |
258.2°C at 760 mmHg |
| ضریب شکست |
1.656 |
| نقطه اشتعال |
110°C |
| خطر نمادها |
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
