ChemNet > CAS > 261762-35-0 5-Bromo-2,3-difluoroanisole
261762-35-0 5-Bromo-2,3-difluoroanisole
نام محصول |
5-Bromo-2,3-difluoroanisole |
مترادف |
2.3-Difluoro-5-Bromoanisole; 5-bromo-1,2-difluoro-3-methoxybenzene |
میدان مغناطیسی |
C7H5BrF2O |
وزن مولکولی |
223.0148 |
InChI |
InChI=1/C7H5BrF2O/c1-11-6-3-4(8)2-5(9)7(6)10/h2-3H,1H3 |
شماره سیایاس |
261762-35-0 |
ساختار مولکولی |
|
تراکم |
1.615g/cm3 |
نقطه غلیان |
193.7°C at 760 mmHg |
ضریب شکست |
1.5 |
نقطه اشتعال |
84.6°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|