ChemNet > CAS > 26227-73-6 N-(4-Methoxybenzylidene)-4-butylaniline
26227-73-6 N-(4-Methoxybenzylidene)-4-butylaniline
| نام محصول |
N-(4-Methoxybenzylidene)-4-butylaniline |
| مترادف |
4-Butyl-N-(4-methoxybenzylidene)aniline; 4-butyl-N-[(E)-(4-methoxyphenyl)methylidene]aniline; Mbba |
| میدان مغناطیسی |
C18H21NO |
| وزن مولکولی |
267.3654 |
| InChI |
InChI=1/C18H21NO/c1-3-4-5-15-6-10-17(11-7-15)19-14-16-8-12-18(20-2)13-9-16/h6-14H,3-5H2,1-2H3/b19-14+ |
| شماره سیایاس |
26227-73-6 |
| تعداد کمیسیون اروپایی |
247-527-4 |
| ساختار مولکولی |
|
| تراکم |
0.97g/cm3 |
| نقطه غلیان |
403.9°C at 760 mmHg |
| ضریب شکست |
1.526 |
| نقطه اشتعال |
160°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
