ChemNet > CAS > 26782-74-1 (S)-2-chloro-3-methylbutyric acid
26782-74-1 (S)-2-chloro-3-methylbutyric acid
نام محصول |
(S)-2-chloro-3-methylbutyric acid |
مترادف |
(S)-(-)-2-Chloro-3-methylbutyric acid; S-2-chloro-3-methylbutyric acid; (2S)-2-chloro-3-methylbutanoic acid |
میدان مغناطیسی |
C5H9ClO2 |
وزن مولکولی |
136.5768 |
InChI |
InChI=1/C5H9ClO2/c1-3(2)4(6)5(7)8/h3-4H,1-2H3,(H,7,8)/t4-/m0/s1 |
شماره سیایاس |
26782-74-1 |
ساختار مولکولی |
|
تراکم |
1.159g/cm3 |
نقطه غلیان |
210.3°C at 760 mmHg |
ضریب شکست |
1.447 |
نقطه اشتعال |
81°C |
خطر نمادها |
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|