ChemNet > CAS > 2719-15-5 2-Methyl-4-nitroacetanilide
2719-15-5 2-Methyl-4-nitroacetanilide
نام محصول |
2-Methyl-4-nitroacetanilide |
مترادف |
N1-(2-Methyl-4-nitrophenyl)acetamide; N-(2-methyl-4-nitrophenyl)acetamide |
میدان مغناطیسی |
C9H10N2O3 |
وزن مولکولی |
194.1873 |
InChI |
InChI=1/C9H10N2O3/c1-6-5-8(11(13)14)3-4-9(6)10-7(2)12/h3-5H,1-2H3,(H,10,12) |
شماره سیایاس |
2719-15-5 |
ساختار مولکولی |
|
تراکم |
1.289g/cm3 |
نقطه ذوب |
198-200℃ |
نقطه غلیان |
393.3°C at 760 mmHg |
ضریب شکست |
1.605 |
نقطه اشتعال |
191.7°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|