ChemNet > CAS > 27311-63-3 1-isoquinolinylmethanol
27311-63-3 1-isoquinolinylmethanol
نام محصول |
1-isoquinolinylmethanol |
مترادف |
isoquinolin-1-ylmethanol |
میدان مغناطیسی |
C10H9NO |
وزن مولکولی |
159.1846 |
InChI |
InChI=1/C10H9NO/c12-7-10-9-4-2-1-3-8(9)5-6-11-10/h1-6,12H,7H2 |
شماره سیایاس |
27311-63-3 |
ساختار مولکولی |
|
تراکم |
1.218g/cm3 |
نقطه ذوب |
80℃ |
نقطه غلیان |
335.1°C at 760 mmHg |
ضریب شکست |
1.667 |
نقطه اشتعال |
156.5°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|