ChemNet > CAS > 280556-71-0 (4-morpholinophenyl)methanol
280556-71-0 (4-morpholinophenyl)methanol
نام محصول |
(4-morpholinophenyl)methanol |
مترادف |
(4-Morpholin-4-yl-phenyl)-methanol |
میدان مغناطیسی |
C11H15NO2 |
وزن مولکولی |
193.2423 |
InChI |
InChI=1/C11H15NO2/c13-9-10-1-3-11(4-2-10)12-5-7-14-8-6-12/h1-4,13H,5-9H2 |
شماره سیایاس |
280556-71-0 |
ساختار مولکولی |
|
تراکم |
1.16g/cm3 |
نقطه غلیان |
378.4°C at 760 mmHg |
ضریب شکست |
1.568 |
نقطه اشتعال |
182.7°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|