ChemNet > CAS > 28229-69-8 3-Bromophenethylalcohol
28229-69-8 3-Bromophenethylalcohol
| نام محصول |
3-Bromophenethylalcohol |
| مترادف |
2-(3-Bromophenyl)-ethanol; 3-Bromophenethylacohol; 3-bromobenzeneethanol; 3-bromophenethyl alcohol; m-bromobenzeneethanol |
| میدان مغناطیسی |
C8H9BrO |
| وزن مولکولی |
201.0605 |
| InChI |
InChI=1/C8H9BrO/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6,10H,4-5H2 |
| شماره سیایاس |
28229-69-8 |
| ساختار مولکولی |
|
| تراکم |
1.479g/cm3 |
| نقطه غلیان |
274.6°C at 760 mmHg |
| ضریب شکست |
1.576 |
| نقطه اشتعال |
119.9°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
