ChemNet > CAS > 28741-08-4 n-Octylboronic acid
28741-08-4 n-Octylboronic acid
نام محصول |
n-Octylboronic acid |
مترادف |
Caprylboronic acid; n-Octaneboronic acid; octylboronic acid; 1-Octylboronic acid |
میدان مغناطیسی |
C8H19BO2 |
وزن مولکولی |
158.0463 |
InChI |
InChI=1/C8H19BO2/c1-2-3-4-5-6-7-8-9(10)11/h10-11H,2-8H2,1H3 |
شماره سیایاس |
28741-08-4 |
ساختار مولکولی |
|
تراکم |
0.89g/cm3 |
نقطه غلیان |
262.6°C at 760 mmHg |
ضریب شکست |
1.427 |
نقطه اشتعال |
112.6°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|