ChemNet > CAS > 29059-24-3 myristic acid, monoester with propane-1,2-diol
29059-24-3 myristic acid, monoester with propane-1,2-diol
| نام محصول |
myristic acid, monoester with propane-1,2-diol |
| مترادف |
Propylene glycol monomyristate; Propylene glycol myristate; Tetradecanoic acid, monoester with 1,2-propanediol; Myristic acid, monoester with propane-1,2-diol; 2-hydroxypropyl tetradecanoate |
| میدان مغناطیسی |
C17H34O3 |
| وزن مولکولی |
286.4501 |
| InChI |
InChI=1/C17H34O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-17(19)20-15-16(2)18/h16,18H,3-15H2,1-2H3 |
| شماره سیایاس |
29059-24-3 |
| تعداد کمیسیون اروپایی |
249-395-3 |
| ساختار مولکولی |
|
| تراکم |
0.922g/cm3 |
| نقطه غلیان |
392.2°C at 760 mmHg |
| ضریب شکست |
1.453 |
| نقطه اشتعال |
149.1°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
|
|
