ChemNet > CAS > 30711-40-1 2-(n-Heptanoyl)thiophene
30711-40-1 2-(n-Heptanoyl)thiophene
نام محصول |
2-(n-Heptanoyl)thiophene |
مترادف |
1-(2-Thienoyl)hexane; 1-(thiophen-2-yl)heptan-1-one |
میدان مغناطیسی |
C11H16OS |
وزن مولکولی |
196.3091 |
InChI |
InChI=1/C11H16OS/c1-2-3-4-5-7-10(12)11-8-6-9-13-11/h6,8-9H,2-5,7H2,1H3 |
شماره سیایاس |
30711-40-1 |
ساختار مولکولی |
|
تراکم |
1.017g/cm3 |
نقطه غلیان |
295.9°C at 760 mmHg |
ضریب شکست |
1.511 |
نقطه اشتعال |
132.7°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|