ChemNet > CAS > 3096-52-4 2-nitro-9-fluorenone
3096-52-4 2-nitro-9-fluorenone
نام محصول |
2-nitro-9-fluorenone |
مترادف |
2-Nitro-9-fluorenone; 4-07-00-01636 (Beilstein Handbook Reference); BRN 2052959; CCRIS 2540; NSC 12365; 9H-Fluoren-9-one, 2-nitro-; 2-nitro-9H-fluoren-9-one |
میدان مغناطیسی |
C13H7NO3 |
وزن مولکولی |
225.1996 |
InChI |
InChI=1/C13H7NO3/c15-13-11-4-2-1-3-9(11)10-6-5-8(14(16)17)7-12(10)13/h1-7H |
شماره سیایاس |
3096-52-4 |
ساختار مولکولی |
|
تراکم |
1.437g/cm3 |
نقطه ذوب |
222-223℃ |
نقطه غلیان |
419°C at 760 mmHg |
ضریب شکست |
1.698 |
نقطه اشتعال |
215.1°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|