ChemNet > CAS > 3319-99-1 2-(2-thienyl)pyridine
3319-99-1 2-(2-thienyl)pyridine
نام محصول |
2-(2-thienyl)pyridine |
مترادف |
2-(2-Pyridyl)thiophene; 2-(thiophen-2-yl)pyridine |
میدان مغناطیسی |
C9H7NS |
وزن مولکولی |
161.2236 |
InChI |
InChI=1/C9H7NS/c1-2-6-10-8(4-1)9-5-3-7-11-9/h1-7H |
شماره سیایاس |
3319-99-1 |
تعداد کمیسیون اروپایی |
222-022-1 |
ساختار مولکولی |
|
تراکم |
1.173g/cm3 |
نقطه غلیان |
268°C at 760 mmHg |
ضریب شکست |
1.604 |
نقطه اشتعال |
115°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|