ChemNet > CAS > 332-43-4 1-(2-chloroethyl)-4-fluorobenzene
332-43-4 1-(2-chloroethyl)-4-fluorobenzene
نام محصول |
1-(2-chloroethyl)-4-fluorobenzene |
مترادف |
4-Fluorophenethyl chloride~2-(4-Fluorophenyl)ethyl chloride |
میدان مغناطیسی |
C8H8ClF |
وزن مولکولی |
158.6005 |
InChI |
InChI=1/C8H8ClF/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2 |
شماره سیایاس |
332-43-4 |
تعداد کمیسیون اروپایی |
206-364-9 |
ساختار مولکولی |
|
تراکم |
1.15g/cm3 |
نقطه غلیان |
204.6°C at 760 mmHg |
ضریب شکست |
1.501 |
نقطه اشتعال |
79.9°C |
خطر نمادها |
|
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|