ChemNet > CAS > 3431-62-7 3-nitrobenzaldoxime
3431-62-7 3-nitrobenzaldoxime
نام محصول |
3-nitrobenzaldoxime |
مترادف |
3-Nitrobenzaldoxime, (3-Nitrobenzaldehyde oxime); 3-Nitrobenzaldehyde oxime; N-hydroxy-1-(3-nitrophenyl)methanimine |
میدان مغناطیسی |
C7H6N2O3 |
وزن مولکولی |
166.1341 |
InChI |
InChI=1/C7H6N2O3/c10-8-5-6-2-1-3-7(4-6)9(11)12/h1-5,10H/b8-5- |
شماره سیایاس |
3431-62-7 |
ساختار مولکولی |
|
تراکم |
1.33g/cm3 |
نقطه ذوب |
123-125℃ |
نقطه غلیان |
295.2°C at 760 mmHg |
ضریب شکست |
1.589 |
نقطه اشتعال |
132.3°C |
خطر نمادها |
|
کدهای خطر |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|