ChemNet > CAS > 3445-84-9 N,N-Bis(2-cyanoethyl)formamide
3445-84-9 N,N-Bis(2-cyanoethyl)formamide
| نام محصول |
N,N-Bis(2-cyanoethyl)formamide |
| مترادف |
3,3-(Formylimino)dipropionitrile; NN-Bis(2-cyanoethyl)formamide, Pract. |
| میدان مغناطیسی |
C7H9N3O |
| وزن مولکولی |
151.1659 |
| InChI |
InChI=1/C7H9N3O/c8-3-1-5-10(7-11)6-2-4-9/h7H,1-2,5-6H2 |
| شماره سیایاس |
3445-84-9 |
| تعداد کمیسیون اروپایی |
222-362-0 |
| ساختار مولکولی |
|
| تراکم |
1.116g/cm3 |
| نقطه غلیان |
444.1°C at 760 mmHg |
| ضریب شکست |
1.476 |
| نقطه اشتعال |
222.4°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|
