ChemNet > CAS > 34688-70-5 Pentamethylphenylacetonitrile
34688-70-5 Pentamethylphenylacetonitrile
نام محصول |
Pentamethylphenylacetonitrile |
مترادف |
2,3,4,5,6-Pentamethylbenzyl cyanide |
میدان مغناطیسی |
C13H17N |
وزن مولکولی |
187.2808 |
InChI |
InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
شماره سیایاس |
34688-70-5 |
ساختار مولکولی |
|
تراکم |
0.95g/cm3 |
نقطه ذوب |
105-107℃ |
نقطه غلیان |
325.9°C at 760 mmHg |
ضریب شکست |
1.519 |
نقطه اشتعال |
160.2°C |
خطر نمادها |
|
کدهای خطر |
R20/22:Harmful by inhalation and if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|