ChemNet > CAS > 347-55-7 2-(trifluoromethylthio)aniline
347-55-7 2-(trifluoromethylthio)aniline
نام محصول |
2-(trifluoromethylthio)aniline |
مترادف |
2-Aminophenyl trifluoromethyl sulphide; 4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoic acid |
میدان مغناطیسی |
C11H11FO4 |
وزن مولکولی |
226.201 |
InChI |
InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) |
شماره سیایاس |
347-55-7 |
تعداد کمیسیون اروپایی |
206-473-1 |
ساختار مولکولی |
|
تراکم |
1.279g/cm3 |
نقطه غلیان |
422.6°C at 760 mmHg |
ضریب شکست |
1.52 |
نقطه اشتعال |
209.4°C |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|